C10H12O3 — CID 101387929
3-(furan-2-ylmethyl)pentane-2,4-dione (PubChem CID 101387929) has the molecular formula C10H12O3 and a molecular weight of 180.20 g/mol. Its IUPAC name is 3-(furan-2-ylmethyl)pentane-2,4-dione.
| Compound Name | 3-(furan-2-ylmethyl)pentane-2,4-dione |
|---|---|
| PubChem CID | 101387929 |
| Molecular Formula | C10H12O3 |
| Molecular Weight | 180.20 g/mol |
| Exact Mass | 180.08 |
| IUPAC Name | 3-(furan-2-ylmethyl)pentane-2,4-dione |
| SMILES | CC(=O)C(Cc1ccco1)C(C)=O |
| InChI | InChI=1S/C10H12O3/c1-7(11)10(8(2)12)6-9-4-3-5-13-9/h3-5,10H,6H2,1-2H3 |
| InChIKey | FCQOGNAQDSTARS-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 47.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.20 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|