2,3-bis(furan-2-yl)propanoic acid

C11H10O4 — CID 151762874

IUPAC2,3-bis(furan-2-yl)propanoic acid
SMILESO=C(O)C(Cc1ccco1)c1ccco1
InChIInChI=1S/C11H10O4/c12-11(13)9(10-4-2-6-15-10)7-8-3-1-5-14-8/h1-6,9H,7H2,(H,12,13)
InChIKeyRQXXZDKDOQEGSO-UHFFFAOYSA-N
MW206.20 g/mol
LogP2.28
Rot. Bonds4

About 2,3-bis(furan-2-yl)propanoic acid

2,3-bis(furan-2-yl)propanoic acid (PubChem CID 151762874) has the molecular formula C11H10O4 and a molecular weight of 206.20 g/mol. Its IUPAC name is 2,3-bis(furan-2-yl)propanoic acid.

Molecular Properties

Compound Name2,3-bis(furan-2-yl)propanoic acid
PubChem CID151762874
Molecular FormulaC11H10O4
Molecular Weight206.20 g/mol
Exact Mass206.06
IUPAC Name2,3-bis(furan-2-yl)propanoic acid
SMILESO=C(O)C(Cc1ccco1)c1ccco1
InChIInChI=1S/C11H10O4/c12-11(13)9(10-4-2-6-15-10)7-8-3-1-5-14-8/h1-6,9H,7H2,(H,12,13)
InChIKeyRQXXZDKDOQEGSO-UHFFFAOYSA-N
XLogP2.28
TPSA63.58 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms15
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500206.20
LogP ≤ 52.28
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 2,3-bis(furan-2-yl)propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

(2R)-2-(furan-2-yl)butanedioic acid
CID 919498
2-(furan-2-yl)-3-sulfanylpropanoic acid
CID 117241167
(2S)-2-(furan-2-ylmethyl)butanoic acid
CID 38989143
2-(furan-2-yl)-4-oxo-4-phenylbutanoic acid
CID 12615241
(2R)-2-(furan-2-ylmethyl)-3-methoxy-3-oxopropanoic acid
CID 97184369
2-(2-methylpropyl)furan;propanoic acid
CID 158583493
3-(furan-2-ylmethyl)pentane-2,4-dione
CID 101387929
(3S)-3-amino-4-(furan-2-yl)butanoic acid
CID 2761693
2-(furan-2-yl)propanedioic acid
CID 19790856
2-(furan-2-yl)ethane-1,1-diol
CID 156698008
(2S)-2-(furan-2-ylmethyl)-3-[(2-methylpropan-2-yl)oxy]-3-oxopropanoic acid
CID 91666114
(3R)-3-(furan-2-ylmethyl)-4-hydroxybutanoic acid
CID 142030961

Frequently Asked Questions

What is the IUPAC name of 2,3-bis(furan-2-yl)propanoic acid?
The IUPAC name of 2,3-bis(furan-2-yl)propanoic acid (CID 151762874) is 2,3-bis(furan-2-yl)propanoic acid.
What is the SMILES notation for 2,3-bis(furan-2-yl)propanoic acid?
The canonical SMILES for 2,3-bis(furan-2-yl)propanoic acid is O=C(O)C(Cc1ccco1)c1ccco1.
What is the InChIKey of 2,3-bis(furan-2-yl)propanoic acid?
The InChIKey is RQXXZDKDOQEGSO-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10O4/c12-11(13)9(10-4-2-6-15-10)7-8-3-1-5-14-8/h1-6,9H,7H2,(H,12,13).
What are the key properties of 2,3-bis(furan-2-yl)propanoic acid?
2,3-bis(furan-2-yl)propanoic acid has a molecular weight of 206.20 g/mol, XLogP of 2.28, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-bis(furan-2-yl)propanoic acid is sourced from PubChem (CID 151762874), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).