C12H19N3O2 — CID 103246742
methyl (E)-4-(1-imidazol-1-ylpropan-2-ylamino)-2-methylbut-2-enoate (PubChem CID 103246742) has the molecular formula C12H19N3O2 and a molecular weight of 237.30 g/mol. Its IUPAC name is methyl (E)-4-(1-imidazol-1-ylpropan-2-ylamino)-2-methylbut-2-enoate.
| Compound Name | methyl (E)-4-(1-imidazol-1-ylpropan-2-ylamino)-2-methylbut-2-enoate |
|---|---|
| PubChem CID | 103246742 |
| Molecular Formula | C12H19N3O2 |
| Molecular Weight | 237.30 g/mol |
| Exact Mass | 237.15 |
| IUPAC Name | methyl (E)-4-(1-imidazol-1-ylpropan-2-ylamino)-2-methylbut-2-enoate |
| SMILES | COC(=O)/C(C)=C/CNC(C)Cn1ccnc1 |
| InChI | InChI=1S/C12H19N3O2/c1-10(12(16)17-3)4-5-14-11(2)8-15-7-6-13-9-15/h4,6-7,9,11,14H,5,8H2,1-3H3/b10-4+ |
| InChIKey | MZLZAQLUMPCGHW-ONNFQVAWSA-N |
| XLogP | 0.98 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.30 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|