C9H21N3S — CID 134594214
(E)-2-N-[(1-methylsulfanylbutan-2-ylamino)methyl]prop-1-ene-1,2-diamine (PubChem CID 134594214) has the molecular formula C9H21N3S and a molecular weight of 203.35 g/mol. Its IUPAC name is (E)-2-N-[(1-methylsulfanylbutan-2-ylamino)methyl]prop-1-ene-1,2-diamine.
| Compound Name | (E)-2-N-[(1-methylsulfanylbutan-2-ylamino)methyl]prop-1-ene-1,2-diamine |
|---|---|
| PubChem CID | 134594214 |
| Molecular Formula | C9H21N3S |
| Molecular Weight | 203.35 g/mol |
| Exact Mass | 203.15 |
| IUPAC Name | (E)-2-N-[(1-methylsulfanylbutan-2-ylamino)methyl]prop-1-ene-1,2-diamine |
| SMILES | CCC(CSC)NCN/C(C)=C/N |
| InChI | InChI=1S/C9H21N3S/c1-4-9(6-13-3)12-7-11-8(2)5-10/h5,9,11-12H,4,6-7,10H2,1-3H3/b8-5+ |
| InChIKey | ORCVNVFCKXYXKN-VMPITWQZSA-N |
| XLogP | 1.08 |
| TPSA | 50.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.35 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|