C7H14N4O3 — CID 61464497
2-[[2-(carbamoylamino)-2-oxoethyl]amino]-N-methylpropanamide (PubChem CID 61464497) has the molecular formula C7H14N4O3 and a molecular weight of 202.21 g/mol. Its IUPAC name is 2-[[2-(carbamoylamino)-2-oxoethyl]amino]-N-methylpropanamide.
| Compound Name | 2-[[2-(carbamoylamino)-2-oxoethyl]amino]-N-methylpropanamide |
|---|---|
| PubChem CID | 61464497 |
| Molecular Formula | C7H14N4O3 |
| Molecular Weight | 202.21 g/mol |
| Exact Mass | 202.11 |
| IUPAC Name | 2-[[2-(carbamoylamino)-2-oxoethyl]amino]-N-methylpropanamide |
| SMILES | CNC(=O)C(C)NCC(=O)NC(N)=O |
| InChI | InChI=1S/C7H14N4O3/c1-4(6(13)9-2)10-3-5(12)11-7(8)14/h4,10H,3H2,1-2H3,(H,9,13)(H3,8,11,12,14) |
| InChIKey | SRYOMPPCWCKFAK-UHFFFAOYSA-N |
| XLogP | -2.09 |
| TPSA | 113.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.21 |
| LogP ≤ 5 | -2.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |