C9H18N4O3 — CID 103108802
2-[[2-(carbamoylamino)-2-oxoethyl]amino]-N-ethyl-N-methylpropanamide (PubChem CID 103108802) has the molecular formula C9H18N4O3 and a molecular weight of 230.27 g/mol. Its IUPAC name is 2-[[2-(carbamoylamino)-2-oxoethyl]amino]-N-ethyl-N-methylpropanamide.
| Compound Name | 2-[[2-(carbamoylamino)-2-oxoethyl]amino]-N-ethyl-N-methylpropanamide |
|---|---|
| PubChem CID | 103108802 |
| Molecular Formula | C9H18N4O3 |
| Molecular Weight | 230.27 g/mol |
| Exact Mass | 230.14 |
| IUPAC Name | 2-[[2-(carbamoylamino)-2-oxoethyl]amino]-N-ethyl-N-methylpropanamide |
| SMILES | CCN(C)C(=O)C(C)NCC(=O)NC(N)=O |
| InChI | InChI=1S/C9H18N4O3/c1-4-13(3)8(15)6(2)11-5-7(14)12-9(10)16/h6,11H,4-5H2,1-3H3,(H3,10,12,14,16) |
| InChIKey | NMINRNSKFCMUPS-UHFFFAOYSA-N |
| XLogP | -1.36 |
| TPSA | 104.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.27 |
| LogP ≤ 5 | -1.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |