C9H17N3O4 — CID 60811365
ethyl 2-[[1-(methylcarbamoylamino)-1-oxopropan-2-yl]amino]acetate (PubChem CID 60811365) has the molecular formula C9H17N3O4 and a molecular weight of 231.25 g/mol. Its IUPAC name is ethyl 2-[[1-(methylcarbamoylamino)-1-oxopropan-2-yl]amino]acetate.
| Compound Name | ethyl 2-[[1-(methylcarbamoylamino)-1-oxopropan-2-yl]amino]acetate |
|---|---|
| PubChem CID | 60811365 |
| Molecular Formula | C9H17N3O4 |
| Molecular Weight | 231.25 g/mol |
| Exact Mass | 231.12 |
| IUPAC Name | ethyl 2-[[1-(methylcarbamoylamino)-1-oxopropan-2-yl]amino]acetate |
| SMILES | CCOC(=O)CNC(C)C(=O)NC(=O)NC |
| InChI | InChI=1S/C9H17N3O4/c1-4-16-7(13)5-11-6(2)8(14)12-9(15)10-3/h6,11H,4-5H2,1-3H3,(H2,10,12,14,15) |
| InChIKey | KDIQONITUKDONR-UHFFFAOYSA-N |
| XLogP | -1.02 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.25 |
| LogP ≤ 5 | -1.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |