C5H11N3O3 — CID 106938638
2-aminooxy-N-(methylcarbamoyl)propanamide (PubChem CID 106938638) has the molecular formula C5H11N3O3 and a molecular weight of 161.16 g/mol. Its IUPAC name is 2-aminooxy-N-(methylcarbamoyl)propanamide.
| Compound Name | 2-aminooxy-N-(methylcarbamoyl)propanamide |
|---|---|
| PubChem CID | 106938638 |
| Molecular Formula | C5H11N3O3 |
| Molecular Weight | 161.16 g/mol |
| Exact Mass | 161.08 |
| IUPAC Name | 2-aminooxy-N-(methylcarbamoyl)propanamide |
| SMILES | CNC(=O)NC(=O)C(C)ON |
| InChI | InChI=1S/C5H11N3O3/c1-3(11-6)4(9)8-5(10)7-2/h3H,6H2,1-2H3,(H2,7,8,9,10) |
| InChIKey | SQPSQRKGSSBWTK-UHFFFAOYSA-N |
| XLogP | -1.28 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.16 |
| LogP ≤ 5 | -1.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|