C8H16N4O4 — CID 83211432
2-[[1-(methylcarbamoylamino)-1-oxopropan-2-yl]amino]ethyl carbamate (PubChem CID 83211432) has the molecular formula C8H16N4O4 and a molecular weight of 232.24 g/mol. Its IUPAC name is 2-[[1-(methylcarbamoylamino)-1-oxopropan-2-yl]amino]ethyl carbamate.
| Compound Name | 2-[[1-(methylcarbamoylamino)-1-oxopropan-2-yl]amino]ethyl carbamate |
|---|---|
| PubChem CID | 83211432 |
| Molecular Formula | C8H16N4O4 |
| Molecular Weight | 232.24 g/mol |
| Exact Mass | 232.12 |
| IUPAC Name | 2-[[1-(methylcarbamoylamino)-1-oxopropan-2-yl]amino]ethyl carbamate |
| SMILES | CNC(=O)NC(=O)C(C)NCCOC(N)=O |
| InChI | InChI=1S/C8H16N4O4/c1-5(6(13)12-8(15)10-2)11-3-4-16-7(9)14/h5,11H,3-4H2,1-2H3,(H2,9,14)(H2,10,12,13,15) |
| InChIKey | BAHGZBMAKMPZAQ-UHFFFAOYSA-N |
| XLogP | -1.48 |
| TPSA | 122.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.24 |
| LogP ≤ 5 | -1.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|