C10H22N4O2 — CID 43084265
2-[3-(dimethylamino)propylamino]-N-(methylcarbamoyl)propanamide (PubChem CID 43084265) has the molecular formula C10H22N4O2 and a molecular weight of 230.31 g/mol. Its IUPAC name is 2-[3-(dimethylamino)propylamino]-N-(methylcarbamoyl)propanamide.
| Compound Name | 2-[3-(dimethylamino)propylamino]-N-(methylcarbamoyl)propanamide |
|---|---|
| PubChem CID | 43084265 |
| Molecular Formula | C10H22N4O2 |
| Molecular Weight | 230.31 g/mol |
| Exact Mass | 230.17 |
| IUPAC Name | 2-[3-(dimethylamino)propylamino]-N-(methylcarbamoyl)propanamide |
| SMILES | CNC(=O)NC(=O)C(C)NCCCN(C)C |
| InChI | InChI=1S/C10H22N4O2/c1-8(9(15)13-10(16)11-2)12-6-5-7-14(3)4/h8,12H,5-7H2,1-4H3,(H2,11,13,15,16) |
| InChIKey | PJJGBDKYPIQEBO-UHFFFAOYSA-N |
| XLogP | -0.63 |
| TPSA | 73.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.31 |
| LogP ≤ 5 | -0.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|