C11H24N4O2 — CID 106045951
N-carbamoyl-2-[3-[methyl(propan-2-yl)amino]propylamino]propanamide (PubChem CID 106045951) has the molecular formula C11H24N4O2 and a molecular weight of 244.34 g/mol. Its IUPAC name is N-carbamoyl-2-[3-[methyl(propan-2-yl)amino]propylamino]propanamide.
| Compound Name | N-carbamoyl-2-[3-[methyl(propan-2-yl)amino]propylamino]propanamide |
|---|---|
| PubChem CID | 106045951 |
| Molecular Formula | C11H24N4O2 |
| Molecular Weight | 244.34 g/mol |
| Exact Mass | 244.19 |
| IUPAC Name | N-carbamoyl-2-[3-[methyl(propan-2-yl)amino]propylamino]propanamide |
| SMILES | CC(NCCCN(C)C(C)C)C(=O)NC(N)=O |
| InChI | InChI=1S/C11H24N4O2/c1-8(2)15(4)7-5-6-13-9(3)10(16)14-11(12)17/h8-9,13H,5-7H2,1-4H3,(H3,12,14,16,17) |
| InChIKey | MVJRDLWUUCCTNE-UHFFFAOYSA-N |
| XLogP | -0.11 |
| TPSA | 87.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.34 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|