C10H19N3O4 — CID 60671920
ethyl 4-[[1-(carbamoylamino)-1-oxopropan-2-yl]amino]butanoate (PubChem CID 60671920) has the molecular formula C10H19N3O4 and a molecular weight of 245.28 g/mol. Its IUPAC name is ethyl 4-[[1-(carbamoylamino)-1-oxopropan-2-yl]amino]butanoate.
| Compound Name | ethyl 4-[[1-(carbamoylamino)-1-oxopropan-2-yl]amino]butanoate |
|---|---|
| PubChem CID | 60671920 |
| Molecular Formula | C10H19N3O4 |
| Molecular Weight | 245.28 g/mol |
| Exact Mass | 245.14 |
| IUPAC Name | ethyl 4-[[1-(carbamoylamino)-1-oxopropan-2-yl]amino]butanoate |
| SMILES | CCOC(=O)CCCNC(C)C(=O)NC(N)=O |
| InChI | InChI=1S/C10H19N3O4/c1-3-17-8(14)5-4-6-12-7(2)9(15)13-10(11)16/h7,12H,3-6H2,1-2H3,(H3,11,13,15,16) |
| InChIKey | TYYVJZXXWWKCSF-UHFFFAOYSA-N |
| XLogP | -0.50 |
| TPSA | 110.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.28 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|