C9H18N2O3 — CID 61464453
ethyl 3-[[1-(methylamino)-1-oxopropan-2-yl]amino]propanoate (PubChem CID 61464453) has the molecular formula C9H18N2O3 and a molecular weight of 202.25 g/mol. Its IUPAC name is ethyl 3-[[1-(methylamino)-1-oxopropan-2-yl]amino]propanoate.
| Compound Name | ethyl 3-[[1-(methylamino)-1-oxopropan-2-yl]amino]propanoate |
|---|---|
| PubChem CID | 61464453 |
| Molecular Formula | C9H18N2O3 |
| Molecular Weight | 202.25 g/mol |
| Exact Mass | 202.13 |
| IUPAC Name | ethyl 3-[[1-(methylamino)-1-oxopropan-2-yl]amino]propanoate |
| SMILES | CCOC(=O)CCNC(C)C(=O)NC |
| InChI | InChI=1S/C9H18N2O3/c1-4-14-8(12)5-6-11-7(2)9(13)10-3/h7,11H,4-6H2,1-3H3,(H,10,13) |
| InChIKey | HPEGUNANHZCWJT-UHFFFAOYSA-N |
| XLogP | -0.34 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.25 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |