C7H15N3O3 — CID 43392786
N-carbamoyl-2-(3-hydroxypropylamino)propanamide (PubChem CID 43392786) has the molecular formula C7H15N3O3 and a molecular weight of 189.21 g/mol. Its IUPAC name is N-carbamoyl-2-(3-hydroxypropylamino)propanamide.
| Compound Name | N-carbamoyl-2-(3-hydroxypropylamino)propanamide |
|---|---|
| PubChem CID | 43392786 |
| Molecular Formula | C7H15N3O3 |
| Molecular Weight | 189.21 g/mol |
| Exact Mass | 189.11 |
| IUPAC Name | N-carbamoyl-2-(3-hydroxypropylamino)propanamide |
| SMILES | CC(NCCCO)C(=O)NC(N)=O |
| InChI | InChI=1S/C7H15N3O3/c1-5(9-3-2-4-11)6(12)10-7(8)13/h5,9,11H,2-4H2,1H3,(H3,8,10,12,13) |
| InChIKey | IOKOZRDLDNEBDW-UHFFFAOYSA-N |
| XLogP | -1.46 |
| TPSA | 104.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.21 |
| LogP ≤ 5 | -1.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|