C8H18N2O2 — CID 103914237
2-(3-hydroxypropylamino)-3-methylbutanamide (PubChem CID 103914237) has the molecular formula C8H18N2O2 and a molecular weight of 174.24 g/mol. Its IUPAC name is 2-(3-hydroxypropylamino)-3-methylbutanamide.
| Compound Name | 2-(3-hydroxypropylamino)-3-methylbutanamide |
|---|---|
| PubChem CID | 103914237 |
| Molecular Formula | C8H18N2O2 |
| Molecular Weight | 174.24 g/mol |
| Exact Mass | 174.14 |
| IUPAC Name | 2-(3-hydroxypropylamino)-3-methylbutanamide |
| SMILES | CC(C)C(NCCCO)C(N)=O |
| InChI | InChI=1S/C8H18N2O2/c1-6(2)7(8(9)12)10-4-3-5-11/h6-7,10-11H,3-5H2,1-2H3,(H2,9,12) |
| InChIKey | RDTRYAZAJZWZLJ-UHFFFAOYSA-N |
| XLogP | -0.53 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.24 |
| LogP ≤ 5 | -0.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|