C19H36N4O6 — CID 123513496
carbamoyl 2-[7-[(1-carbamoyloxy-3-methyl-1-oxobutan-2-yl)amino]heptylamino]-3-methylbutanoate (PubChem CID 123513496) has the molecular formula C19H36N4O6 and a molecular weight of 416.52 g/mol. Its IUPAC name is carbamoyl 2-[7-[(1-carbamoyloxy-3-methyl-1-oxobutan-2-yl)amino]heptylamino]-3-methylbutanoate.
| Compound Name | carbamoyl 2-[7-[(1-carbamoyloxy-3-methyl-1-oxobutan-2-yl)amino]heptylamino]-3-methylbutanoate |
|---|---|
| PubChem CID | 123513496 |
| Molecular Formula | C19H36N4O6 |
| Molecular Weight | 416.52 g/mol |
| Exact Mass | 416.26 |
| IUPAC Name | carbamoyl 2-[7-[(1-carbamoyloxy-3-methyl-1-oxobutan-2-yl)amino]heptylamino]-3-methylbutanoate |
| SMILES | CC(C)C(NCCCCCCCNC(C(=O)OC(N)=O)C(C)C)C(=O)OC(N)=O |
| InChI | InChI=1S/C19H36N4O6/c1-12(2)14(16(24)28-18(20)26)22-10-8-6-5-7-9-11-23-15(13(3)4)17(25)29-19(21)27/h12-15,22-23H,5-11H2,1-4H3,(H2,20,26)(H2,21,27) |
| InChIKey | YNWDSQAJBRFMDJ-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 162.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.52 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|