C29H40N4O4 — CID 71117452
2-[2-[5-[[1-(2-carbamoylphenyl)-3-methyl-1-oxobutan-2-yl]amino]pentylamino]-3-methylbutanoyl]benzamide (PubChem CID 71117452) has the molecular formula C29H40N4O4 and a molecular weight of 508.66 g/mol. Its IUPAC name is 2-[2-[5-[[1-(2-carbamoylphenyl)-3-methyl-1-oxobutan-2-yl]amino]pentylamino]-3-methylbutanoyl]benzamide.
| Compound Name | 2-[2-[5-[[1-(2-carbamoylphenyl)-3-methyl-1-oxobutan-2-yl]amino]pentylamino]-3-methylbutanoyl]benzamide |
|---|---|
| PubChem CID | 71117452 |
| Molecular Formula | C29H40N4O4 |
| Molecular Weight | 508.66 g/mol |
| Exact Mass | 508.30 |
| IUPAC Name | 2-[2-[5-[[1-(2-carbamoylphenyl)-3-methyl-1-oxobutan-2-yl]amino]pentylamino]-3-methylbutanoyl]benzamide |
| SMILES | CC(C)C(NCCCCCNC(C(=O)c1ccccc1C(N)=O)C(C)C)C(=O)c1ccccc1C(N)=O |
| InChI | InChI=1S/C29H40N4O4/c1-18(2)24(26(34)20-12-6-8-14-22(20)28(30)36)32-16-10-5-11-17-33-25(19(3)4)27(35)21-13-7-9-15-23(21)29(31)37/h6-9,12-15,18-19,24-25,32-33H,5,10-11,16-17H2,1-4H3,(H2,30,36)(H2,31,37) |
| InChIKey | MPJFKDIIEHYMAU-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 144.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.66 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|