C11H23NO3 — CID 79360906
methyl 2-[(3-hydroxy-3-methylbutyl)amino]-3-methylbutanoate (PubChem CID 79360906) has the molecular formula C11H23NO3 and a molecular weight of 217.31 g/mol. Its IUPAC name is methyl 2-[(3-hydroxy-3-methylbutyl)amino]-3-methylbutanoate.
| Compound Name | methyl 2-[(3-hydroxy-3-methylbutyl)amino]-3-methylbutanoate |
|---|---|
| PubChem CID | 79360906 |
| Molecular Formula | C11H23NO3 |
| Molecular Weight | 217.31 g/mol |
| Exact Mass | 217.17 |
| IUPAC Name | methyl 2-[(3-hydroxy-3-methylbutyl)amino]-3-methylbutanoate |
| SMILES | COC(=O)C(NCCC(C)(C)O)C(C)C |
| InChI | InChI=1S/C11H23NO3/c1-8(2)9(10(13)15-5)12-7-6-11(3,4)14/h8-9,12,14H,6-7H2,1-5H3 |
| InChIKey | NRKDDTNFCUMVQD-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.31 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |