C13H25NO4 — CID 21309732
tert-butyl (2S)-2-[(3-methoxy-3-oxopropyl)amino]-3-methylbutanoate (PubChem CID 21309732) has the molecular formula C13H25NO4 and a molecular weight of 259.35 g/mol. Its IUPAC name is tert-butyl (2S)-2-[(3-methoxy-3-oxopropyl)amino]-3-methylbutanoate.
| Compound Name | tert-butyl (2S)-2-[(3-methoxy-3-oxopropyl)amino]-3-methylbutanoate |
|---|---|
| PubChem CID | 21309732 |
| Molecular Formula | C13H25NO4 |
| Molecular Weight | 259.35 g/mol |
| Exact Mass | 259.18 |
| IUPAC Name | tert-butyl (2S)-2-[(3-methoxy-3-oxopropyl)amino]-3-methylbutanoate |
| SMILES | COC(=O)CCN[C@H](C(=O)OC(C)(C)C)C(C)C |
| InChI | InChI=1S/C13H25NO4/c1-9(2)11(12(16)18-13(3,4)5)14-8-7-10(15)17-6/h9,11,14H,7-8H2,1-6H3/t11-/m0/s1 |
| InChIKey | LQGJJRWQXSCWGU-NSHDSACASA-N |
| XLogP | 1.51 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.35 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |