About methyl 2-[(2-hydroxy-2,3-dimethylbutyl)amino]-3-methylbutanoate
methyl 2-[(2-hydroxy-2,3-dimethylbutyl)amino]-3-methylbutanoate (PubChem CID 114492798) has the molecular formula C12H25NO3
and a molecular weight of 231.34 g/mol. Its IUPAC name is methyl 2-[(2-hydroxy-2,3-dimethylbutyl)amino]-3-methylbutanoate.
Analyze methyl 2-[(2-hydroxy-2,3-dimethylbutyl)amino]-3-methylbutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-[(2-hydroxy-2,3-dimethylbutyl)amino]-3-methylbutanoate?
The IUPAC name of methyl 2-[(2-hydroxy-2,3-dimethylbutyl)amino]-3-methylbutanoate (CID 114492798) is methyl 2-[(2-hydroxy-2,3-dimethylbutyl)amino]-3-methylbutanoate.
What is the SMILES notation for methyl 2-[(2-hydroxy-2,3-dimethylbutyl)amino]-3-methylbutanoate?
The canonical SMILES for methyl 2-[(2-hydroxy-2,3-dimethylbutyl)amino]-3-methylbutanoate is COC(=O)C(NCC(C)(O)C(C)C)C(C)C.
What is the InChIKey of methyl 2-[(2-hydroxy-2,3-dimethylbutyl)amino]-3-methylbutanoate?
The InChIKey is QTPUMHVBOAHLPY-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H25NO3/c1-8(2)10(11(14)16-6)13-7-12(5,15)9(3)4/h8-10,13,15H,7H2,1-6H3.
What are the key properties of methyl 2-[(2-hydroxy-2,3-dimethylbutyl)amino]-3-methylbutanoate?
methyl 2-[(2-hydroxy-2,3-dimethylbutyl)amino]-3-methylbutanoate has a molecular weight of 231.34 g/mol, XLogP of 1.18, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[(2-hydroxy-2,3-dimethylbutyl)amino]-3-methylbutanoate is sourced from PubChem (CID 114492798), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).