methyl 2-[(2-hydroxy-2,3-dimethylbutyl)amino]-3-methylbutanoate

C12H25NO3 — CID 114492798

IUPACmethyl 2-[(2-hydroxy-2,3-dimethylbutyl)amino]-3-methylbutanoate
SMILESCOC(=O)C(NCC(C)(O)C(C)C)C(C)C
InChIInChI=1S/C12H25NO3/c1-8(2)10(11(14)16-6)13-7-12(5,15)9(3)4/h8-10,13,15H,7H2,1-6H3
InChIKeyQTPUMHVBOAHLPY-UHFFFAOYSA-N
MW231.34 g/mol
LogP1.18
Rot. Bonds6

About methyl 2-[(2-hydroxy-2,3-dimethylbutyl)amino]-3-methylbutanoate

methyl 2-[(2-hydroxy-2,3-dimethylbutyl)amino]-3-methylbutanoate (PubChem CID 114492798) has the molecular formula C12H25NO3 and a molecular weight of 231.34 g/mol. Its IUPAC name is methyl 2-[(2-hydroxy-2,3-dimethylbutyl)amino]-3-methylbutanoate.

Molecular Properties

Compound Namemethyl 2-[(2-hydroxy-2,3-dimethylbutyl)amino]-3-methylbutanoate
PubChem CID114492798
Molecular FormulaC12H25NO3
Molecular Weight231.34 g/mol
Exact Mass231.18
IUPAC Namemethyl 2-[(2-hydroxy-2,3-dimethylbutyl)amino]-3-methylbutanoate
SMILESCOC(=O)C(NCC(C)(O)C(C)C)C(C)C
InChIInChI=1S/C12H25NO3/c1-8(2)10(11(14)16-6)13-7-12(5,15)9(3)4/h8-10,13,15H,7H2,1-6H3
InChIKeyQTPUMHVBOAHLPY-UHFFFAOYSA-N
XLogP1.18
TPSA58.56 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds6
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500231.34
LogP ≤ 51.18
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze methyl 2-[(2-hydroxy-2,3-dimethylbutyl)amino]-3-methylbutanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2-[(2-hydroxy-2,3-dimethylbutyl)amino]-3-methylbutanoate?
The IUPAC name of methyl 2-[(2-hydroxy-2,3-dimethylbutyl)amino]-3-methylbutanoate (CID 114492798) is methyl 2-[(2-hydroxy-2,3-dimethylbutyl)amino]-3-methylbutanoate.
What is the SMILES notation for methyl 2-[(2-hydroxy-2,3-dimethylbutyl)amino]-3-methylbutanoate?
The canonical SMILES for methyl 2-[(2-hydroxy-2,3-dimethylbutyl)amino]-3-methylbutanoate is COC(=O)C(NCC(C)(O)C(C)C)C(C)C.
What is the InChIKey of methyl 2-[(2-hydroxy-2,3-dimethylbutyl)amino]-3-methylbutanoate?
The InChIKey is QTPUMHVBOAHLPY-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H25NO3/c1-8(2)10(11(14)16-6)13-7-12(5,15)9(3)4/h8-10,13,15H,7H2,1-6H3.
What are the key properties of methyl 2-[(2-hydroxy-2,3-dimethylbutyl)amino]-3-methylbutanoate?
methyl 2-[(2-hydroxy-2,3-dimethylbutyl)amino]-3-methylbutanoate has a molecular weight of 231.34 g/mol, XLogP of 1.18, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[(2-hydroxy-2,3-dimethylbutyl)amino]-3-methylbutanoate is sourced from PubChem (CID 114492798), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).