C11H20O5 — CID 114497667
dimethyl 2-(2-hydroxy-2,3-dimethylbutyl)propanedioate (PubChem CID 114497667) has the molecular formula C11H20O5 and a molecular weight of 232.28 g/mol. Its IUPAC name is dimethyl 2-(2-hydroxy-2,3-dimethylbutyl)propanedioate.
| Compound Name | dimethyl 2-(2-hydroxy-2,3-dimethylbutyl)propanedioate |
|---|---|
| PubChem CID | 114497667 |
| Molecular Formula | C11H20O5 |
| Molecular Weight | 232.28 g/mol |
| Exact Mass | 232.13 |
| IUPAC Name | dimethyl 2-(2-hydroxy-2,3-dimethylbutyl)propanedioate |
| SMILES | COC(=O)C(CC(C)(O)C(C)C)C(=O)OC |
| InChI | InChI=1S/C11H20O5/c1-7(2)11(3,14)6-8(9(12)15-4)10(13)16-5/h7-8,14H,6H2,1-5H3 |
| InChIKey | MQZZLOAUEKHVCD-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.28 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|