C10H21NO3 — CID 101480223
methyl (3R,4S)-3-amino-6-hydroxy-4,6-dimethylheptanoate (PubChem CID 101480223) has the molecular formula C10H21NO3 and a molecular weight of 203.28 g/mol. Its IUPAC name is methyl (3R,4S)-3-amino-6-hydroxy-4,6-dimethylheptanoate.
| Compound Name | methyl (3R,4S)-3-amino-6-hydroxy-4,6-dimethylheptanoate |
|---|---|
| PubChem CID | 101480223 |
| Molecular Formula | C10H21NO3 |
| Molecular Weight | 203.28 g/mol |
| Exact Mass | 203.15 |
| IUPAC Name | methyl (3R,4S)-3-amino-6-hydroxy-4,6-dimethylheptanoate |
| SMILES | COC(=O)C[C@@H](N)[C@@H](C)CC(C)(C)O |
| InChI | InChI=1S/C10H21NO3/c1-7(6-10(2,3)13)8(11)5-9(12)14-4/h7-8,13H,5-6,11H2,1-4H3/t7-,8+/m0/s1 |
| InChIKey | CHJRIZWJTUJBDJ-JGVFFNPUSA-N |
| XLogP | 0.67 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.28 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |