C12H26FNO3Si — CID 59806230
methyl (3R,4S)-3-amino-4-[tert-butyl(dimethyl)silyl]oxy-5-fluoropentanoate (PubChem CID 59806230) has the molecular formula C12H26FNO3Si and a molecular weight of 279.43 g/mol. Its IUPAC name is methyl (3R,4S)-3-amino-4-[tert-butyl(dimethyl)silyl]oxy-5-fluoropentanoate.
| Compound Name | methyl (3R,4S)-3-amino-4-[tert-butyl(dimethyl)silyl]oxy-5-fluoropentanoate |
|---|---|
| PubChem CID | 59806230 |
| Molecular Formula | C12H26FNO3Si |
| Molecular Weight | 279.43 g/mol |
| Exact Mass | 279.17 |
| IUPAC Name | methyl (3R,4S)-3-amino-4-[tert-butyl(dimethyl)silyl]oxy-5-fluoropentanoate |
| SMILES | COC(=O)C[C@@H](N)[C@@H](CF)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C12H26FNO3Si/c1-12(2,3)18(5,6)17-10(8-13)9(14)7-11(15)16-4/h9-10H,7-8,14H2,1-6H3/t9-,10-/m1/s1 |
| InChIKey | JJUKNMGAHVHHPO-NXEZZACHSA-N |
| XLogP | 2.24 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.43 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|