C13H25IO4Si — CID 89272980
methyl (3R)-3-[tert-butyl(dimethyl)silyl]oxy-6-iodo-5-oxohexanoate (PubChem CID 89272980) has the molecular formula C13H25IO4Si and a molecular weight of 400.33 g/mol. Its IUPAC name is methyl (3R)-3-[tert-butyl(dimethyl)silyl]oxy-6-iodo-5-oxohexanoate.
| Compound Name | methyl (3R)-3-[tert-butyl(dimethyl)silyl]oxy-6-iodo-5-oxohexanoate |
|---|---|
| PubChem CID | 89272980 |
| Molecular Formula | C13H25IO4Si |
| Molecular Weight | 400.33 g/mol |
| Exact Mass | 400.06 |
| IUPAC Name | methyl (3R)-3-[tert-butyl(dimethyl)silyl]oxy-6-iodo-5-oxohexanoate |
| SMILES | COC(=O)C[C@@H](CC(=O)CI)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C13H25IO4Si/c1-13(2,3)19(5,6)18-11(7-10(15)9-14)8-12(16)17-4/h11H,7-9H2,1-6H3/t11-/m1/s1 |
| InChIKey | ISRRCQZZGAETIM-LLVKDONJSA-N |
| XLogP | 3.33 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.33 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|