About deuterio(fluoro)methane;methyl 3-[tert-butyl(dimethyl)silyl]oxy-5-oxohexanoate;methyl 3-hydroxy-5-oxohexanoate
deuterio(fluoro)methane;methyl 3-[tert-butyl(dimethyl)silyl]oxy-5-oxohexanoate;methyl 3-hydroxy-5-oxohexanoate (PubChem CID 161088796) has the molecular formula C21H41FO8Si
and a molecular weight of 469.64 g/mol. Its IUPAC name is deuterio(fluoro)methane;methyl 3-[tert-butyl(dimethyl)silyl]oxy-5-oxohexanoate;methyl 3-hydroxy-5-oxohexanoate.
Molecular Properties
| Compound Name | deuterio(fluoro)methane;methyl 3-[tert-butyl(dimethyl)silyl]oxy-5-oxohexanoate;methyl 3-hydroxy-5-oxohexanoate |
| PubChem CID | 161088796 |
| Molecular Formula | C21H41FO8Si |
| Molecular Weight | 469.64 g/mol |
| Exact Mass | 469.26 |
| IUPAC Name | deuterio(fluoro)methane;methyl 3-[tert-butyl(dimethyl)silyl]oxy-5-oxohexanoate;methyl 3-hydroxy-5-oxohexanoate |
| SMILES | COC(=O)CC(CC(C)=O)O[Si](C)(C)C(C)(C)C.COC(=O)CC(O)CC(C)=O.[2H]CF |
| InChI | InChI=1S/C13H26O4Si.C7H12O4.CH3F/c1-10(14)8-11(9-12(15)16-5)17-18(6,7)13(2,3)4;1-5(8)3-6(9)4-7(10)11-2;1-2/h11H,8-9H2,1-7H3;6,9H,3-4H2,1-2H3;1H3/i;;1D |
| InChIKey | UGWSZMMMWPWPKF-PRQZKWGPSA-N |
| XLogP | 3.39 |
| TPSA | 116.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 469.64 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze deuterio(fluoro)methane;methyl 3-[tert-butyl(dimethyl)silyl]oxy-5-oxohexanoate;methyl 3-hydroxy-5-oxohexanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of deuterio(fluoro)methane;methyl 3-[tert-butyl(dimethyl)silyl]oxy-5-oxohexanoate;methyl 3-hydroxy-5-oxohexanoate?
The IUPAC name of deuterio(fluoro)methane;methyl 3-[tert-butyl(dimethyl)silyl]oxy-5-oxohexanoate;methyl 3-hydroxy-5-oxohexanoate (CID 161088796) is deuterio(fluoro)methane;methyl 3-[tert-butyl(dimethyl)silyl]oxy-5-oxohexanoate;methyl 3-hydroxy-5-oxohexanoate.
What is the SMILES notation for deuterio(fluoro)methane;methyl 3-[tert-butyl(dimethyl)silyl]oxy-5-oxohexanoate;methyl 3-hydroxy-5-oxohexanoate?
The canonical SMILES for deuterio(fluoro)methane;methyl 3-[tert-butyl(dimethyl)silyl]oxy-5-oxohexanoate;methyl 3-hydroxy-5-oxohexanoate is COC(=O)CC(CC(C)=O)O[Si](C)(C)C(C)(C)C.COC(=O)CC(O)CC(C)=O.[2H]CF.
What is the InChIKey of deuterio(fluoro)methane;methyl 3-[tert-butyl(dimethyl)silyl]oxy-5-oxohexanoate;methyl 3-hydroxy-5-oxohexanoate?
The InChIKey is UGWSZMMMWPWPKF-PRQZKWGPSA-N. The full InChI is InChI=1S/C13H26O4Si.C7H12O4.CH3F/c1-10(14)8-11(9-12(15)16-5)17-18(6,7)13(2,3)4;1-5(8)3-6(9)4-7(10)11-2;1-2/h11H,8-9H2,1-7H3;6,9H,3-4H2,1-2H3;1H3/i;;1D.
What are the key properties of deuterio(fluoro)methane;methyl 3-[tert-butyl(dimethyl)silyl]oxy-5-oxohexanoate;methyl 3-hydroxy-5-oxohexanoate?
deuterio(fluoro)methane;methyl 3-[tert-butyl(dimethyl)silyl]oxy-5-oxohexanoate;methyl 3-hydroxy-5-oxohexanoate has a molecular weight of 469.64 g/mol, XLogP of 3.39, 10 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for deuterio(fluoro)methane;methyl 3-[tert-butyl(dimethyl)silyl]oxy-5-oxohexanoate;methyl 3-hydroxy-5-oxohexanoate is sourced from PubChem (CID 161088796), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).