C19H36O4Si — CID 71814812
methyl (3R,5S,8E)-5-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-8-methylundeca-8,10-dienoate (PubChem CID 71814812) has the molecular formula C19H36O4Si and a molecular weight of 356.58 g/mol. Its IUPAC name is methyl (3R,5S,8E)-5-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-8-methylundeca-8,10-dienoate.
| Compound Name | methyl (3R,5S,8E)-5-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-8-methylundeca-8,10-dienoate |
|---|---|
| PubChem CID | 71814812 |
| Molecular Formula | C19H36O4Si |
| Molecular Weight | 356.58 g/mol |
| Exact Mass | 356.24 |
| IUPAC Name | methyl (3R,5S,8E)-5-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-8-methylundeca-8,10-dienoate |
| SMILES | C=C/C=C(\C)CC[C@@H](C[C@@H](O)CC(=O)OC)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C19H36O4Si/c1-9-10-15(2)11-12-17(13-16(20)14-18(21)22-6)23-24(7,8)19(3,4)5/h9-10,16-17,20H,1,11-14H2,2-8H3/b15-10+/t16-,17+/m1/s1 |
| InChIKey | NGDGLYWDDWVQPP-GUJBPHSMSA-N |
| XLogP | 4.60 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.58 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|