C21H44Br2O4Si2 — CID 11342188
(2R,6R,8R)-1,9-dibromo-2,8-bis[[tert-butyl(dimethyl)silyl]oxy]-6-hydroxynonan-4-one (PubChem CID 11342188) has the molecular formula C21H44Br2O4Si2 and a molecular weight of 576.56 g/mol. Its IUPAC name is (2R,6R,8R)-1,9-dibromo-2,8-bis[[tert-butyl(dimethyl)silyl]oxy]-6-hydroxynonan-4-one.
| Compound Name | (2R,6R,8R)-1,9-dibromo-2,8-bis[[tert-butyl(dimethyl)silyl]oxy]-6-hydroxynonan-4-one |
|---|---|
| PubChem CID | 11342188 |
| Molecular Formula | C21H44Br2O4Si2 |
| Molecular Weight | 576.56 g/mol |
| Exact Mass | 574.11 |
| IUPAC Name | (2R,6R,8R)-1,9-dibromo-2,8-bis[[tert-butyl(dimethyl)silyl]oxy]-6-hydroxynonan-4-one |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H](CBr)CC(=O)C[C@H](O)C[C@H](CBr)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C21H44Br2O4Si2/c1-20(2,3)28(7,8)26-18(14-22)12-16(24)11-17(25)13-19(15-23)27-29(9,10)21(4,5)6/h16,18-19,24H,11-15H2,1-10H3/t16-,18+,19+/m0/s1 |
| InChIKey | UZBYOPCWNZZPRN-QXAKKESOSA-N |
| XLogP | 6.66 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.56 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|