C18H36O3Si — CID 102009682
(E,2S,7R)-2-[tert-butyl(dimethyl)silyl]oxy-7-hydroxy-4,9-dimethyldec-3-en-5-one (PubChem CID 102009682) has the molecular formula C18H36O3Si and a molecular weight of 328.57 g/mol. Its IUPAC name is (E,2S,7R)-2-[tert-butyl(dimethyl)silyl]oxy-7-hydroxy-4,9-dimethyldec-3-en-5-one.
| Compound Name | (E,2S,7R)-2-[tert-butyl(dimethyl)silyl]oxy-7-hydroxy-4,9-dimethyldec-3-en-5-one |
|---|---|
| PubChem CID | 102009682 |
| Molecular Formula | C18H36O3Si |
| Molecular Weight | 328.57 g/mol |
| Exact Mass | 328.24 |
| IUPAC Name | (E,2S,7R)-2-[tert-butyl(dimethyl)silyl]oxy-7-hydroxy-4,9-dimethyldec-3-en-5-one |
| SMILES | C/C(=C\[C@H](C)O[Si](C)(C)C(C)(C)C)C(=O)C[C@H](O)CC(C)C |
| InChI | InChI=1S/C18H36O3Si/c1-13(2)10-16(19)12-17(20)14(3)11-15(4)21-22(8,9)18(5,6)7/h11,13,15-16,19H,10,12H2,1-9H3/b14-11+/t15-,16+/m0/s1 |
| InChIKey | WCNGDIXWMMLFIY-QNHDLBPPSA-N |
| XLogP | 4.71 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.57 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|