C17H34O2Si — CID 11500377
(2E,4R,5R,6E)-5-[tert-butyl(dimethyl)silyl]oxy-2,4,6-trimethylocta-2,6-dien-1-ol (PubChem CID 11500377) has the molecular formula C17H34O2Si and a molecular weight of 298.54 g/mol. Its IUPAC name is (2E,4R,5R,6E)-5-[tert-butyl(dimethyl)silyl]oxy-2,4,6-trimethylocta-2,6-dien-1-ol.
| Compound Name | (2E,4R,5R,6E)-5-[tert-butyl(dimethyl)silyl]oxy-2,4,6-trimethylocta-2,6-dien-1-ol |
|---|---|
| PubChem CID | 11500377 |
| Molecular Formula | C17H34O2Si |
| Molecular Weight | 298.54 g/mol |
| Exact Mass | 298.23 |
| IUPAC Name | (2E,4R,5R,6E)-5-[tert-butyl(dimethyl)silyl]oxy-2,4,6-trimethylocta-2,6-dien-1-ol |
| SMILES | C/C=C(\C)[C@H](O[Si](C)(C)C(C)(C)C)[C@H](C)/C=C(\C)CO |
| InChI | InChI=1S/C17H34O2Si/c1-10-14(3)16(15(4)11-13(2)12-18)19-20(8,9)17(5,6)7/h10-11,15-16,18H,12H2,1-9H3/b13-11+,14-10+/t15-,16+/m1/s1 |
| InChIKey | FWFISFARECCSCK-BXTMBTEBSA-N |
| XLogP | 4.92 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.54 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|