C23H44O3Si — CID 102342235
(2R,4R,6E,8R,9R,10E)-9-[tert-butyl(dimethyl)silyl]oxy-2,4,6,8,10-pentamethyldodeca-6,10-dienoic acid (PubChem CID 102342235) has the molecular formula C23H44O3Si and a molecular weight of 396.69 g/mol. Its IUPAC name is (2R,4R,6E,8R,9R,10E)-9-[tert-butyl(dimethyl)silyl]oxy-2,4,6,8,10-pentamethyldodeca-6,10-dienoic acid.
| Compound Name | (2R,4R,6E,8R,9R,10E)-9-[tert-butyl(dimethyl)silyl]oxy-2,4,6,8,10-pentamethyldodeca-6,10-dienoic acid |
|---|---|
| PubChem CID | 102342235 |
| Molecular Formula | C23H44O3Si |
| Molecular Weight | 396.69 g/mol |
| Exact Mass | 396.31 |
| IUPAC Name | (2R,4R,6E,8R,9R,10E)-9-[tert-butyl(dimethyl)silyl]oxy-2,4,6,8,10-pentamethyldodeca-6,10-dienoic acid |
| SMILES | C/C=C(\C)[C@H](O[Si](C)(C)C(C)(C)C)[C@H](C)/C=C(\C)C[C@H](C)C[C@@H](C)C(=O)O |
| InChI | InChI=1S/C23H44O3Si/c1-12-18(4)21(26-27(10,11)23(7,8)9)19(5)14-16(2)13-17(3)15-20(6)22(24)25/h12,14,17,19-21H,13,15H2,1-11H3,(H,24,25)/b16-14+,18-12+/t17-,19+,20+,21-/m0/s1 |
| InChIKey | IWEREKOLTZCGSK-KGUMNTGNSA-N |
| XLogP | 7.06 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.69 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|