C9H20O3Si — CID 14358757
(2R)-2-[tert-butyl(dimethyl)silyl]oxypropanoic acid (PubChem CID 14358757) has the molecular formula C9H20O3Si and a molecular weight of 204.34 g/mol. Its IUPAC name is (2R)-2-[tert-butyl(dimethyl)silyl]oxypropanoic acid.
| Compound Name | (2R)-2-[tert-butyl(dimethyl)silyl]oxypropanoic acid |
|---|---|
| PubChem CID | 14358757 |
| Molecular Formula | C9H20O3Si |
| Molecular Weight | 204.34 g/mol |
| Exact Mass | 204.12 |
| IUPAC Name | (2R)-2-[tert-butyl(dimethyl)silyl]oxypropanoic acid |
| SMILES | C[C@@H](O[Si](C)(C)C(C)(C)C)C(=O)O |
| InChI | InChI=1S/C9H20O3Si/c1-7(8(10)11)12-13(5,6)9(2,3)4/h7H,1-6H3,(H,10,11)/t7-/m1/s1 |
| InChIKey | VWUVOHLUOBJYHD-SSDOTTSWSA-N |
| XLogP | 2.48 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.34 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|