C10H20Br2O2Si — CID 10970420
(3S)-1,1-dibromo-3-[tert-butyl(dimethyl)silyl]oxybutan-2-one (PubChem CID 10970420) has the molecular formula C10H20Br2O2Si and a molecular weight of 360.16 g/mol. Its IUPAC name is (3S)-1,1-dibromo-3-[tert-butyl(dimethyl)silyl]oxybutan-2-one.
| Compound Name | (3S)-1,1-dibromo-3-[tert-butyl(dimethyl)silyl]oxybutan-2-one |
|---|---|
| PubChem CID | 10970420 |
| Molecular Formula | C10H20Br2O2Si |
| Molecular Weight | 360.16 g/mol |
| Exact Mass | 357.96 |
| IUPAC Name | (3S)-1,1-dibromo-3-[tert-butyl(dimethyl)silyl]oxybutan-2-one |
| SMILES | C[C@H](O[Si](C)(C)C(C)(C)C)C(=O)C(Br)Br |
| InChI | InChI=1S/C10H20Br2O2Si/c1-7(8(13)9(11)12)14-15(5,6)10(2,3)4/h7,9H,1-6H3/t7-/m0/s1 |
| InChIKey | DDFCANSGFVTMFJ-ZETCQYMHSA-N |
| XLogP | 4.08 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.16 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|