C17H32O7Si — CID 10177567
ethyl 2-[2-[2-[tert-butyl(dimethyl)silyl]oxypropanoyloxy]propanoyloxy]propanoate (PubChem CID 10177567) has the molecular formula C17H32O7Si and a molecular weight of 376.52 g/mol. Its IUPAC name is ethyl 2-[2-[2-[tert-butyl(dimethyl)silyl]oxypropanoyloxy]propanoyloxy]propanoate.
| Compound Name | ethyl 2-[2-[2-[tert-butyl(dimethyl)silyl]oxypropanoyloxy]propanoyloxy]propanoate |
|---|---|
| PubChem CID | 10177567 |
| Molecular Formula | C17H32O7Si |
| Molecular Weight | 376.52 g/mol |
| Exact Mass | 376.19 |
| IUPAC Name | ethyl 2-[2-[2-[tert-butyl(dimethyl)silyl]oxypropanoyloxy]propanoyloxy]propanoate |
| SMILES | CCOC(=O)C(C)OC(=O)C(C)OC(=O)C(C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C17H32O7Si/c1-10-21-14(18)11(2)22-15(19)12(3)23-16(20)13(4)24-25(8,9)17(5,6)7/h11-13H,10H2,1-9H3 |
| InChIKey | IGMGNXGEBRGMMX-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.52 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|