C14H31NO3Si — CID 57178030
ethyl (2S,3R)-3-[tert-butyl(dimethyl)silyl]oxy-2-(methylaminomethyl)butanoate (PubChem CID 57178030) has the molecular formula C14H31NO3Si and a molecular weight of 289.49 g/mol. Its IUPAC name is ethyl (2S,3R)-3-[tert-butyl(dimethyl)silyl]oxy-2-(methylaminomethyl)butanoate.
| Compound Name | ethyl (2S,3R)-3-[tert-butyl(dimethyl)silyl]oxy-2-(methylaminomethyl)butanoate |
|---|---|
| PubChem CID | 57178030 |
| Molecular Formula | C14H31NO3Si |
| Molecular Weight | 289.49 g/mol |
| Exact Mass | 289.21 |
| IUPAC Name | ethyl (2S,3R)-3-[tert-butyl(dimethyl)silyl]oxy-2-(methylaminomethyl)butanoate |
| SMILES | CCOC(=O)[C@@H](CNC)[C@@H](C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C14H31NO3Si/c1-9-17-13(16)12(10-15-6)11(2)18-19(7,8)14(3,4)5/h11-12,15H,9-10H2,1-8H3/t11-,12+/m1/s1 |
| InChIKey | GXDZHXUFVZFQSH-NEPJUHHUSA-N |
| XLogP | 2.80 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.49 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|