C22H39NO3Si — CID 10069177
tert-butyl (2R,3R)-2-[(benzylamino)methyl]-3-[tert-butyl(dimethyl)silyl]oxybutanoate (PubChem CID 10069177) has the molecular formula C22H39NO3Si and a molecular weight of 393.64 g/mol. Its IUPAC name is tert-butyl (2R,3R)-2-[(benzylamino)methyl]-3-[tert-butyl(dimethyl)silyl]oxybutanoate.
| Compound Name | tert-butyl (2R,3R)-2-[(benzylamino)methyl]-3-[tert-butyl(dimethyl)silyl]oxybutanoate |
|---|---|
| PubChem CID | 10069177 |
| Molecular Formula | C22H39NO3Si |
| Molecular Weight | 393.64 g/mol |
| Exact Mass | 393.27 |
| IUPAC Name | tert-butyl (2R,3R)-2-[(benzylamino)methyl]-3-[tert-butyl(dimethyl)silyl]oxybutanoate |
| SMILES | C[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](CNCc1ccccc1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C22H39NO3Si/c1-17(26-27(8,9)22(5,6)7)19(20(24)25-21(2,3)4)16-23-15-18-13-11-10-12-14-18/h10-14,17,19,23H,15-16H2,1-9H3/t17-,19-/m1/s1 |
| InChIKey | ZMOAWJALEHLLAE-IEBWSBKVSA-N |
| XLogP | 5.14 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.64 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|