C23H39NO5Si — CID 70057588
(4S,5S)-2-amino-5-benzyl-4-[tert-butyl(dimethyl)silyl]oxy-6-[(2-methylpropan-2-yl)oxy]-6-oxohexanoic acid (PubChem CID 70057588) has the molecular formula C23H39NO5Si and a molecular weight of 437.65 g/mol. Its IUPAC name is (4S,5S)-2-amino-5-benzyl-4-[tert-butyl(dimethyl)silyl]oxy-6-[(2-methylpropan-2-yl)oxy]-6-oxohexanoic acid.
| Compound Name | (4S,5S)-2-amino-5-benzyl-4-[tert-butyl(dimethyl)silyl]oxy-6-[(2-methylpropan-2-yl)oxy]-6-oxohexanoic acid |
|---|---|
| PubChem CID | 70057588 |
| Molecular Formula | C23H39NO5Si |
| Molecular Weight | 437.65 g/mol |
| Exact Mass | 437.26 |
| IUPAC Name | (4S,5S)-2-amino-5-benzyl-4-[tert-butyl(dimethyl)silyl]oxy-6-[(2-methylpropan-2-yl)oxy]-6-oxohexanoic acid |
| SMILES | CC(C)(C)OC(=O)[C@@H](Cc1ccccc1)[C@H](CC(N)C(=O)O)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C23H39NO5Si/c1-22(2,3)28-21(27)17(14-16-12-10-9-11-13-16)19(15-18(24)20(25)26)29-30(7,8)23(4,5)6/h9-13,17-19H,14-15,24H2,1-8H3,(H,25,26)/t17-,18?,19-/m0/s1 |
| InChIKey | HODDYINECHOYET-JVUMBYKBSA-N |
| XLogP | 4.38 |
| TPSA | 98.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.65 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|