C23H32N2O3 — CID 57287882
tert-butyl 4,5-diamino-2-benzyl-3-hydroxy-5-(4-methylphenyl)pentanoate (PubChem CID 57287882) has the molecular formula C23H32N2O3 and a molecular weight of 384.52 g/mol. Its IUPAC name is tert-butyl 4,5-diamino-2-benzyl-3-hydroxy-5-(4-methylphenyl)pentanoate.
| Compound Name | tert-butyl 4,5-diamino-2-benzyl-3-hydroxy-5-(4-methylphenyl)pentanoate |
|---|---|
| PubChem CID | 57287882 |
| Molecular Formula | C23H32N2O3 |
| Molecular Weight | 384.52 g/mol |
| Exact Mass | 384.24 |
| IUPAC Name | tert-butyl 4,5-diamino-2-benzyl-3-hydroxy-5-(4-methylphenyl)pentanoate |
| SMILES | Cc1ccc(C(N)C(N)C(O)C(Cc2ccccc2)C(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C23H32N2O3/c1-15-10-12-17(13-11-15)19(24)20(25)21(26)18(22(27)28-23(2,3)4)14-16-8-6-5-7-9-16/h5-13,18-21,26H,14,24-25H2,1-4H3 |
| InChIKey | TZPIYIAMBXWZJD-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 98.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.52 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |