C13H30N2O3Si — CID 59831403
(2S,4R)-4-[tert-butyl(dimethyl)silyl]oxy-2,5-bis(methylamino)pentanoic acid (PubChem CID 59831403) has the molecular formula C13H30N2O3Si and a molecular weight of 290.48 g/mol. Its IUPAC name is (2S,4R)-4-[tert-butyl(dimethyl)silyl]oxy-2,5-bis(methylamino)pentanoic acid.
| Compound Name | (2S,4R)-4-[tert-butyl(dimethyl)silyl]oxy-2,5-bis(methylamino)pentanoic acid |
|---|---|
| PubChem CID | 59831403 |
| Molecular Formula | C13H30N2O3Si |
| Molecular Weight | 290.48 g/mol |
| Exact Mass | 290.20 |
| IUPAC Name | (2S,4R)-4-[tert-butyl(dimethyl)silyl]oxy-2,5-bis(methylamino)pentanoic acid |
| SMILES | CNC[C@@H](C[C@H](NC)C(=O)O)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C13H30N2O3Si/c1-13(2,3)19(6,7)18-10(9-14-4)8-11(15-5)12(16)17/h10-11,14-15H,8-9H2,1-7H3,(H,16,17)/t10-,11+/m1/s1 |
| InChIKey | TYLKFGGHWUTGHM-MNOVXSKESA-N |
| XLogP | 1.66 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.48 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|