C14H27NO3Si — CID 87076440
(4S)-4-[tert-butyl(dimethyl)silyl]oxy-4-cyano-2-propan-2-ylbutanoic acid (PubChem CID 87076440) has the molecular formula C14H27NO3Si and a molecular weight of 285.46 g/mol. Its IUPAC name is (4S)-4-[tert-butyl(dimethyl)silyl]oxy-4-cyano-2-propan-2-ylbutanoic acid.
| Compound Name | (4S)-4-[tert-butyl(dimethyl)silyl]oxy-4-cyano-2-propan-2-ylbutanoic acid |
|---|---|
| PubChem CID | 87076440 |
| Molecular Formula | C14H27NO3Si |
| Molecular Weight | 285.46 g/mol |
| Exact Mass | 285.18 |
| IUPAC Name | (4S)-4-[tert-butyl(dimethyl)silyl]oxy-4-cyano-2-propan-2-ylbutanoic acid |
| SMILES | CC(C)C(C[C@@H](C#N)O[Si](C)(C)C(C)(C)C)C(=O)O |
| InChI | InChI=1S/C14H27NO3Si/c1-10(2)12(13(16)17)8-11(9-15)18-19(6,7)14(3,4)5/h10-12H,8H2,1-7H3,(H,16,17)/t11-,12?/m0/s1 |
| InChIKey | RQSMSBVRMLFWIV-PXYINDEMSA-N |
| XLogP | 3.65 |
| TPSA | 70.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.46 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|