C20H33NOSi — CID 135071982
2-[tert-butyl(dimethyl)silyl]oxytetradeca-6,12-diynenitrile (PubChem CID 135071982) has the molecular formula C20H33NOSi and a molecular weight of 331.58 g/mol. Its IUPAC name is 2-[tert-butyl(dimethyl)silyl]oxytetradeca-6,12-diynenitrile.
| Compound Name | 2-[tert-butyl(dimethyl)silyl]oxytetradeca-6,12-diynenitrile |
|---|---|
| PubChem CID | 135071982 |
| Molecular Formula | C20H33NOSi |
| Molecular Weight | 331.58 g/mol |
| Exact Mass | 331.23 |
| IUPAC Name | 2-[tert-butyl(dimethyl)silyl]oxytetradeca-6,12-diynenitrile |
| SMILES | CC#CCCCCC#CCCCC(C#N)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C20H33NOSi/c1-7-8-9-10-11-12-13-14-15-16-17-19(18-21)22-23(5,6)20(2,3)4/h19H,9-12,15-17H2,1-6H3 |
| InChIKey | RAIRBDRMCJRMFW-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.58 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|