C27H50OSi — CID 71377830
tert-butyl-[(11R)-henicosa-6,9-diyn-11-yl]oxy-dimethylsilane (PubChem CID 71377830) has the molecular formula C27H50OSi and a molecular weight of 418.78 g/mol. Its IUPAC name is tert-butyl-[(11R)-henicosa-6,9-diyn-11-yl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[(11R)-henicosa-6,9-diyn-11-yl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 71377830 |
| Molecular Formula | C27H50OSi |
| Molecular Weight | 418.78 g/mol |
| Exact Mass | 418.36 |
| IUPAC Name | tert-butyl-[(11R)-henicosa-6,9-diyn-11-yl]oxy-dimethylsilane |
| SMILES | CCCCCC#CCC#C[C@@H](CCCCCCCCCC)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C27H50OSi/c1-8-10-12-14-16-18-20-22-24-26(28-29(6,7)27(3,4)5)25-23-21-19-17-15-13-11-9-2/h26H,8-16,18,20-22,24H2,1-7H3/t26-/m1/s1 |
| InChIKey | VXOKOLJBNUBNFB-AREMUKBSSA-N |
| XLogP | 8.88 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.78 |
| LogP ≤ 5 | 8.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|