C12H25NOSi — CID 11009699
(2R,4S)-4-[tert-butyl(dimethyl)silyl]oxy-2-methylpentanenitrile (PubChem CID 11009699) has the molecular formula C12H25NOSi and a molecular weight of 227.42 g/mol. Its IUPAC name is (2R,4S)-4-[tert-butyl(dimethyl)silyl]oxy-2-methylpentanenitrile.
| Compound Name | (2R,4S)-4-[tert-butyl(dimethyl)silyl]oxy-2-methylpentanenitrile |
|---|---|
| PubChem CID | 11009699 |
| Molecular Formula | C12H25NOSi |
| Molecular Weight | 227.42 g/mol |
| Exact Mass | 227.17 |
| IUPAC Name | (2R,4S)-4-[tert-butyl(dimethyl)silyl]oxy-2-methylpentanenitrile |
| SMILES | CC(C#N)C[C@H](C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C12H25NOSi/c1-10(9-13)8-11(2)14-15(6,7)12(3,4)5/h10-11H,8H2,1-7H3/t10?,11-/m0/s1 |
| InChIKey | CKJHCJRVUNEJSW-DTIOYNMSSA-N |
| XLogP | 3.95 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.42 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|