C11H27NOSi — CID 156904543
(2R)-2-[tert-butyl(dimethyl)silyl]oxy-N,N-dimethylpropan-1-amine (PubChem CID 156904543) has the molecular formula C11H27NOSi and a molecular weight of 217.43 g/mol. Its IUPAC name is (2R)-2-[tert-butyl(dimethyl)silyl]oxy-N,N-dimethylpropan-1-amine.
| Compound Name | (2R)-2-[tert-butyl(dimethyl)silyl]oxy-N,N-dimethylpropan-1-amine |
|---|---|
| PubChem CID | 156904543 |
| Molecular Formula | C11H27NOSi |
| Molecular Weight | 217.43 g/mol |
| Exact Mass | 217.19 |
| IUPAC Name | (2R)-2-[tert-butyl(dimethyl)silyl]oxy-N,N-dimethylpropan-1-amine |
| SMILES | C[C@H](CN(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C11H27NOSi/c1-10(9-12(5)6)13-14(7,8)11(2,3)4/h10H,9H2,1-8H3/t10-/m1/s1 |
| InChIKey | RAJVUUDCIFTOIK-SNVBAGLBSA-N |
| XLogP | 2.96 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.43 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|