C15H38ClNOSi2 — CID 87920596
tert-butyl-chloro-dimethylsilane;2-[tert-butyl(dimethyl)silyl]oxypropan-1-amine (PubChem CID 87920596) has the molecular formula C15H38ClNOSi2 and a molecular weight of 340.10 g/mol. Its IUPAC name is tert-butyl-chloro-dimethylsilane;2-[tert-butyl(dimethyl)silyl]oxypropan-1-amine.
| Compound Name | tert-butyl-chloro-dimethylsilane;2-[tert-butyl(dimethyl)silyl]oxypropan-1-amine |
|---|---|
| PubChem CID | 87920596 |
| Molecular Formula | C15H38ClNOSi2 |
| Molecular Weight | 340.10 g/mol |
| Exact Mass | 339.22 |
| IUPAC Name | tert-butyl-chloro-dimethylsilane;2-[tert-butyl(dimethyl)silyl]oxypropan-1-amine |
| SMILES | CC(C)(C)[Si](C)(C)Cl.CC(CN)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C9H23NOSi.C6H15ClSi/c1-8(7-10)11-12(5,6)9(2,3)4;1-6(2,3)8(4,5)7/h8H,7,10H2,1-6H3;1-5H3 |
| InChIKey | XFOPEHOHNSSFAV-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.10 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|