C14H24O2Si — CID 11747133
(2S)-2-[tert-butyl(dimethyl)silyl]oxyocta-5,7-diyn-4-ol (PubChem CID 11747133) has the molecular formula C14H24O2Si and a molecular weight of 252.43 g/mol. Its IUPAC name is (2S)-2-[tert-butyl(dimethyl)silyl]oxyocta-5,7-diyn-4-ol.
| Compound Name | (2S)-2-[tert-butyl(dimethyl)silyl]oxyocta-5,7-diyn-4-ol |
|---|---|
| PubChem CID | 11747133 |
| Molecular Formula | C14H24O2Si |
| Molecular Weight | 252.43 g/mol |
| Exact Mass | 252.15 |
| IUPAC Name | (2S)-2-[tert-butyl(dimethyl)silyl]oxyocta-5,7-diyn-4-ol |
| SMILES | C#CC#CC(O)C[C@H](C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C14H24O2Si/c1-8-9-10-13(15)11-12(2)16-17(6,7)14(3,4)5/h1,12-13,15H,11H2,2-7H3/t12-,13?/m0/s1 |
| InChIKey | MVMVVACRGFYSLD-UEWDXFNNSA-N |
| XLogP | 2.78 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.43 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|