C16H36O2Si — CID 154722181
(4R,6R)-6-[tert-butyl(dimethyl)silyl]oxy-3-ethyl-4-methylheptan-3-ol (PubChem CID 154722181) has the molecular formula C16H36O2Si and a molecular weight of 288.55 g/mol. Its IUPAC name is (4R,6R)-6-[tert-butyl(dimethyl)silyl]oxy-3-ethyl-4-methylheptan-3-ol.
| Compound Name | (4R,6R)-6-[tert-butyl(dimethyl)silyl]oxy-3-ethyl-4-methylheptan-3-ol |
|---|---|
| PubChem CID | 154722181 |
| Molecular Formula | C16H36O2Si |
| Molecular Weight | 288.55 g/mol |
| Exact Mass | 288.25 |
| IUPAC Name | (4R,6R)-6-[tert-butyl(dimethyl)silyl]oxy-3-ethyl-4-methylheptan-3-ol |
| SMILES | CCC(O)(CC)[C@H](C)C[C@@H](C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C16H36O2Si/c1-10-16(17,11-2)13(3)12-14(4)18-19(8,9)15(5,6)7/h13-14,17H,10-12H2,1-9H3/t13-,14-/m1/s1 |
| InChIKey | CWBWFBFPVCJEKL-ZIAGYGMSSA-N |
| XLogP | 4.97 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.55 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|