C18H38O2Si2 — CID 11416604
(3S,5R)-5-[tert-butyl(dimethyl)silyl]oxy-7-methyl-1-trimethylsilyloct-1-yn-3-ol (PubChem CID 11416604) has the molecular formula C18H38O2Si2 and a molecular weight of 342.67 g/mol. Its IUPAC name is (3S,5R)-5-[tert-butyl(dimethyl)silyl]oxy-7-methyl-1-trimethylsilyloct-1-yn-3-ol.
| Compound Name | (3S,5R)-5-[tert-butyl(dimethyl)silyl]oxy-7-methyl-1-trimethylsilyloct-1-yn-3-ol |
|---|---|
| PubChem CID | 11416604 |
| Molecular Formula | C18H38O2Si2 |
| Molecular Weight | 342.67 g/mol |
| Exact Mass | 342.24 |
| IUPAC Name | (3S,5R)-5-[tert-butyl(dimethyl)silyl]oxy-7-methyl-1-trimethylsilyloct-1-yn-3-ol |
| SMILES | CC(C)C[C@H](C[C@H](O)C#C[Si](C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C18H38O2Si2/c1-15(2)13-17(20-22(9,10)18(3,4)5)14-16(19)11-12-21(6,7)8/h15-17,19H,13-14H2,1-10H3/t16-,17-/m1/s1 |
| InChIKey | LYYHOIWOGZHAHO-IAGOWNOFSA-N |
| XLogP | 5.05 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.67 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|