C21H41IO2Si3 — CID 11628015
[(3R,4R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-6-iodohexa-1,5-diynyl]-trimethylsilane (PubChem CID 11628015) has the molecular formula C21H41IO2Si3 and a molecular weight of 536.72 g/mol. Its IUPAC name is [(3R,4R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-6-iodohexa-1,5-diynyl]-trimethylsilane.
| Compound Name | [(3R,4R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-6-iodohexa-1,5-diynyl]-trimethylsilane |
|---|---|
| PubChem CID | 11628015 |
| Molecular Formula | C21H41IO2Si3 |
| Molecular Weight | 536.72 g/mol |
| Exact Mass | 536.15 |
| IUPAC Name | [(3R,4R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-6-iodohexa-1,5-diynyl]-trimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)O[C@H](C#CI)[C@@H](C#C[Si](C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C21H41IO2Si3/c1-20(2,3)26(10,11)23-18(14-16-22)19(15-17-25(7,8)9)24-27(12,13)21(4,5)6/h18-19H,1-13H3/t18-,19-/m1/s1 |
| InChIKey | GRZFGSWHRUCUCL-RTBURBONSA-N |
| XLogP | 7.04 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.72 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|