C16H34O2SSi2 — CID 99772475
tert-butyl-dimethyl-[(3S)-5-(methylsulfanylmethoxy)-1-trimethylsilylpent-1-yn-3-yl]oxysilane (PubChem CID 99772475) has the molecular formula C16H34O2SSi2 and a molecular weight of 346.69 g/mol. Its IUPAC name is tert-butyl-dimethyl-[(3S)-5-(methylsulfanylmethoxy)-1-trimethylsilylpent-1-yn-3-yl]oxysilane.
| Compound Name | tert-butyl-dimethyl-[(3S)-5-(methylsulfanylmethoxy)-1-trimethylsilylpent-1-yn-3-yl]oxysilane |
|---|---|
| PubChem CID | 99772475 |
| Molecular Formula | C16H34O2SSi2 |
| Molecular Weight | 346.69 g/mol |
| Exact Mass | 346.18 |
| IUPAC Name | tert-butyl-dimethyl-[(3S)-5-(methylsulfanylmethoxy)-1-trimethylsilylpent-1-yn-3-yl]oxysilane |
| SMILES | CSCOCC[C@@H](C#C[Si](C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C16H34O2SSi2/c1-16(2,3)21(8,9)18-15(10-12-17-14-19-4)11-13-20(5,6)7/h15H,10,12,14H2,1-9H3/t15-/m0/s1 |
| InChIKey | UDSPDAJITNEKQQ-HNNXBMFYSA-N |
| XLogP | 4.98 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.69 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|