C20H40O4Si2 — CID 75295434
ethyl 4,6-bis[[tert-butyl(dimethyl)silyl]oxy]hex-2-ynoate (PubChem CID 75295434) has the molecular formula C20H40O4Si2 and a molecular weight of 400.71 g/mol. Its IUPAC name is ethyl 4,6-bis[[tert-butyl(dimethyl)silyl]oxy]hex-2-ynoate.
| Compound Name | ethyl 4,6-bis[[tert-butyl(dimethyl)silyl]oxy]hex-2-ynoate |
|---|---|
| PubChem CID | 75295434 |
| Molecular Formula | C20H40O4Si2 |
| Molecular Weight | 400.71 g/mol |
| Exact Mass | 400.25 |
| IUPAC Name | ethyl 4,6-bis[[tert-butyl(dimethyl)silyl]oxy]hex-2-ynoate |
| SMILES | CCOC(=O)C#CC(CCO[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C20H40O4Si2/c1-12-22-18(21)14-13-17(24-26(10,11)20(5,6)7)15-16-23-25(8,9)19(2,3)4/h17H,12,15-16H2,1-11H3 |
| InChIKey | YZZVOTMRAPNBOM-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.71 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_5', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|